C6H6Cl6 — CID 157415991
3,3,3-trichloroprop-1-ene (PubChem CID 157415991) has the molecular formula C6H6Cl6 and a molecular weight of 290.83 g/mol. Its IUPAC name is 3,3,3-trichloroprop-1-ene.
| Compound Name | 3,3,3-trichloroprop-1-ene |
|---|---|
| PubChem CID | 157415991 |
| Molecular Formula | C6H6Cl6 |
| Molecular Weight | 290.83 g/mol |
| Exact Mass | 287.86 |
| IUPAC Name | 3,3,3-trichloroprop-1-ene |
| SMILES | C=CC(Cl)(Cl)Cl.C=CC(Cl)(Cl)Cl |
| InChI | InChI=1S/2C3H3Cl3/c2*1-2-3(4,5)6/h2*2H,1H2 |
| InChIKey | BOVUBPLDBLOJOQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.83 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|