C4H3Cl7 — CID 160710284
chloroethene;1,1,1,2,2,2-hexachloroethane (PubChem CID 160710284) has the molecular formula C4H3Cl7 and a molecular weight of 299.24 g/mol. Its IUPAC name is chloroethene;1,1,1,2,2,2-hexachloroethane.
| Compound Name | chloroethene;1,1,1,2,2,2-hexachloroethane |
|---|---|
| PubChem CID | 160710284 |
| Molecular Formula | C4H3Cl7 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 295.81 |
| IUPAC Name | chloroethene;1,1,1,2,2,2-hexachloroethane |
| SMILES | C=CCl.ClC(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C2Cl6.C2H3Cl/c3-1(4,5)2(6,7)8;1-2-3/h;2H,1H2 |
| InChIKey | RRTOKQIOMHSDNA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|