C5H7Cl6NO — CID 174821411
N,N-dimethylformamide;1,1,1,2,2,2-hexachloroethane (PubChem CID 174821411) has the molecular formula C5H7Cl6NO and a molecular weight of 309.84 g/mol. Its IUPAC name is N,N-dimethylformamide;1,1,1,2,2,2-hexachloroethane.
| Compound Name | N,N-dimethylformamide;1,1,1,2,2,2-hexachloroethane |
|---|---|
| PubChem CID | 174821411 |
| Molecular Formula | C5H7Cl6NO |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 306.87 |
| IUPAC Name | N,N-dimethylformamide;1,1,1,2,2,2-hexachloroethane |
| SMILES | CN(C)C=O.ClC(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C3H7NO.C2Cl6/c1-4(2)3-5;3-1(4,5)2(6,7)8/h3H,1-2H3; |
| InChIKey | MIYICGRLKNJJLW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|