C3Cl10 — CID 87168985
1,1,1,2,2,2-hexachloroethane;tetrachloromethane (PubChem CID 87168985) has the molecular formula C3Cl10 and a molecular weight of 390.56 g/mol. Its IUPAC name is 1,1,1,2,2,2-hexachloroethane;tetrachloromethane.
| Compound Name | 1,1,1,2,2,2-hexachloroethane;tetrachloromethane |
|---|---|
| PubChem CID | 87168985 |
| Molecular Formula | C3Cl10 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 385.69 |
| IUPAC Name | 1,1,1,2,2,2-hexachloroethane;tetrachloromethane |
| SMILES | ClC(Cl)(Cl)C(Cl)(Cl)Cl.ClC(Cl)(Cl)Cl |
| InChI | InChI=1S/C2Cl6.CCl4/c3-1(4,5)2(6,7)8;2-1(3,4)5 |
| InChIKey | VJMVAOZKFWUZCK-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|