C5H8F5OP — CID 87128019
1-[ethyl(methyl)phosphoryl]-1,1,2,2,2-pentafluoroethane (PubChem CID 87128019) has the molecular formula C5H8F5OP and a molecular weight of 210.08 g/mol. Its IUPAC name is 1-[ethyl(methyl)phosphoryl]-1,1,2,2,2-pentafluoroethane.
| Compound Name | 1-[ethyl(methyl)phosphoryl]-1,1,2,2,2-pentafluoroethane |
|---|---|
| PubChem CID | 87128019 |
| Molecular Formula | C5H8F5OP |
| Molecular Weight | 210.08 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | 1-[ethyl(methyl)phosphoryl]-1,1,2,2,2-pentafluoroethane |
| SMILES | CCP(C)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H8F5OP/c1-3-12(2,11)5(9,10)4(6,7)8/h3H2,1-2H3 |
| InChIKey | QTLLNBOPBOJFAU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.08 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|