C8H12F7O2P — CID 6421636
1-[ethyl(propan-2-yloxy)phosphoryl]-1,1,2,2,3,3,3-heptafluoropropane (PubChem CID 6421636) has the molecular formula C8H12F7O2P and a molecular weight of 304.14 g/mol. Its IUPAC name is 1-[ethyl(propan-2-yloxy)phosphoryl]-1,1,2,2,3,3,3-heptafluoropropane.
| Compound Name | 1-[ethyl(propan-2-yloxy)phosphoryl]-1,1,2,2,3,3,3-heptafluoropropane |
|---|---|
| PubChem CID | 6421636 |
| Molecular Formula | C8H12F7O2P |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1-[ethyl(propan-2-yloxy)phosphoryl]-1,1,2,2,3,3,3-heptafluoropropane |
| SMILES | CCP(=O)(OC(C)C)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H12F7O2P/c1-4-18(16,17-5(2)3)8(14,15)6(9,10)7(11,12)13/h5H,4H2,1-3H3 |
| InChIKey | GTTDJANBCSYMFZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|