C9H16F3O4P — CID 134894233
3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-one (PubChem CID 134894233) has the molecular formula C9H16F3O4P and a molecular weight of 276.19 g/mol. Its IUPAC name is 3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-one.
| Compound Name | 3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 134894233 |
| Molecular Formula | C9H16F3O4P |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-one |
| SMILES | CC(C)OP(=O)(CC(=O)C(F)(F)F)OC(C)C |
| InChI | InChI=1S/C9H16F3O4P/c1-6(2)15-17(14,16-7(3)4)5-8(13)9(10,11)12/h6-7H,5H2,1-4H3 |
| InChIKey | BZSLKKGTRDCDFA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|