About 3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-one
3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-one (PubChem CID 134894233) has the molecular formula C9H16F3O4P
and a molecular weight of 276.19 g/mol. Its IUPAC name is 3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-one.
Molecular Properties
| Compound Name | 3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-one |
| PubChem CID | 134894233 |
| Molecular Formula | C9H16F3O4P |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-one |
| SMILES | CC(C)OP(=O)(CC(=O)C(F)(F)F)OC(C)C |
| InChI | InChI=1S/C9H16F3O4P/c1-6(2)15-17(14,16-7(3)4)5-8(13)9(10,11)12/h6-7H,5H2,1-4H3 |
| InChIKey | BZSLKKGTRDCDFA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-one?
The IUPAC name of 3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-one (CID 134894233) is 3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-one.
What is the SMILES notation for 3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-one?
The canonical SMILES for 3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-one is CC(C)OP(=O)(CC(=O)C(F)(F)F)OC(C)C.
What is the InChIKey of 3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-one?
The InChIKey is BZSLKKGTRDCDFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3O4P/c1-6(2)15-17(14,16-7(3)4)5-8(13)9(10,11)12/h6-7H,5H2,1-4H3.
What are the key properties of 3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-one?
3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-one has a molecular weight of 276.19 g/mol, XLogP of 3.16, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-one is sourced from PubChem (CID 134894233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).