C11H22NO4P — CID 2785305
N-[di(propan-2-yloxy)phosphorylmethyl]-2-methylprop-2-enamide (PubChem CID 2785305) has the molecular formula C11H22NO4P and a molecular weight of 263.27 g/mol. Its IUPAC name is N-[di(propan-2-yloxy)phosphorylmethyl]-2-methylprop-2-enamide.
| Compound Name | N-[di(propan-2-yloxy)phosphorylmethyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 2785305 |
| Molecular Formula | C11H22NO4P |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-[di(propan-2-yloxy)phosphorylmethyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCP(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C11H22NO4P/c1-8(2)11(13)12-7-17(14,15-9(3)4)16-10(5)6/h9-10H,1,7H2,2-6H3,(H,12,13) |
| InChIKey | QLHYKHADILYJTD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|