C8H19N2O3P — CID 12609538
2-di(propan-2-yloxy)phosphorylethanimidamide (PubChem CID 12609538) has the molecular formula C8H19N2O3P and a molecular weight of 222.22 g/mol. Its IUPAC name is 2-di(propan-2-yloxy)phosphorylethanimidamide.
| Compound Name | 2-di(propan-2-yloxy)phosphorylethanimidamide |
|---|---|
| PubChem CID | 12609538 |
| Molecular Formula | C8H19N2O3P |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 2-di(propan-2-yloxy)phosphorylethanimidamide |
| SMILES | [H]/N=C(\N)CP(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C8H19N2O3P/c1-6(2)12-14(11,5-8(9)10)13-7(3)4/h6-7H,5H2,1-4H3,(H3,9,10) |
| InChIKey | OVDHTSWKUGGKOI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|