C4H12N2O6P2 — CID 154148068
(4-amino-4-imino-2-phosphonobutan-2-yl)phosphonic acid (PubChem CID 154148068) has the molecular formula C4H12N2O6P2 and a molecular weight of 246.10 g/mol. Its IUPAC name is (4-amino-4-imino-2-phosphonobutan-2-yl)phosphonic acid.
| Compound Name | (4-amino-4-imino-2-phosphonobutan-2-yl)phosphonic acid |
|---|---|
| PubChem CID | 154148068 |
| Molecular Formula | C4H12N2O6P2 |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | (4-amino-4-imino-2-phosphonobutan-2-yl)phosphonic acid |
| SMILES | [H]/N=C(\N)CC(C)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C4H12N2O6P2/c1-4(2-3(5)6,13(7,8)9)14(10,11)12/h2H2,1H3,(H3,5,6)(H2,7,8,9)(H2,10,11,12) |
| InChIKey | CYLQJCKASLPYRG-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 164.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|