C8H16N2O2 — CID 159975596
(3-amino-3-iminopropyl) 2,2-dimethylpropanoate (PubChem CID 159975596) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is (3-amino-3-iminopropyl) 2,2-dimethylpropanoate.
| Compound Name | (3-amino-3-iminopropyl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 159975596 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | (3-amino-3-iminopropyl) 2,2-dimethylpropanoate |
| SMILES | [H]/N=C(\N)CCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C8H16N2O2/c1-8(2,3)7(11)12-5-4-6(9)10/h4-5H2,1-3H3,(H3,9,10) |
| InChIKey | VPHDAILOFFSKTJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|