C7H14N2O — CID 71322397
4,4-dimethyl-3-oxopentanimidamide (PubChem CID 71322397) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is 4,4-dimethyl-3-oxopentanimidamide.
| Compound Name | 4,4-dimethyl-3-oxopentanimidamide |
|---|---|
| PubChem CID | 71322397 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 4,4-dimethyl-3-oxopentanimidamide |
| SMILES | [H]/N=C(\N)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C7H14N2O/c1-7(2,3)5(10)4-6(8)9/h4H2,1-3H3,(H3,8,9) |
| InChIKey | MWEKVTYHYGFVKZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|