C8H15N3O2 — CID 58678963
N-(diaminomethylidene)-4,4-dimethyl-3-oxopentanamide (PubChem CID 58678963) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is N-(diaminomethylidene)-4,4-dimethyl-3-oxopentanamide.
| Compound Name | N-(diaminomethylidene)-4,4-dimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 58678963 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | N-(diaminomethylidene)-4,4-dimethyl-3-oxopentanamide |
| SMILES | CC(C)(C)C(=O)CC(=O)N=C(N)N |
| InChI | InChI=1S/C8H15N3O2/c1-8(2,3)5(12)4-6(13)11-7(9)10/h4H2,1-3H3,(H4,9,10,11,13) |
| InChIKey | UMOLRANFJLERHH-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|