About N-(diaminomethylidene)-4,4-dimethyl-3-oxopentanamide
N-(diaminomethylidene)-4,4-dimethyl-3-oxopentanamide (PubChem CID 58678963) has the molecular formula C8H15N3O2
and a molecular weight of 185.23 g/mol. Its IUPAC name is N-(diaminomethylidene)-4,4-dimethyl-3-oxopentanamide.
Molecular Properties
| Compound Name | N-(diaminomethylidene)-4,4-dimethyl-3-oxopentanamide |
| PubChem CID | 58678963 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | N-(diaminomethylidene)-4,4-dimethyl-3-oxopentanamide |
| SMILES | CC(C)(C)C(=O)CC(=O)N=C(N)N |
| InChI | InChI=1S/C8H15N3O2/c1-8(2,3)5(12)4-6(13)11-7(9)10/h4H2,1-3H3,(H4,9,10,11,13) |
| InChIKey | UMOLRANFJLERHH-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(diaminomethylidene)-4,4-dimethyl-3-oxopentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diaminomethylidene)-4,4-dimethyl-3-oxopentanamide?
The IUPAC name of N-(diaminomethylidene)-4,4-dimethyl-3-oxopentanamide (CID 58678963) is N-(diaminomethylidene)-4,4-dimethyl-3-oxopentanamide.
What is the SMILES notation for N-(diaminomethylidene)-4,4-dimethyl-3-oxopentanamide?
The canonical SMILES for N-(diaminomethylidene)-4,4-dimethyl-3-oxopentanamide is CC(C)(C)C(=O)CC(=O)N=C(N)N.
What is the InChIKey of N-(diaminomethylidene)-4,4-dimethyl-3-oxopentanamide?
The InChIKey is UMOLRANFJLERHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O2/c1-8(2,3)5(12)4-6(13)11-7(9)10/h4H2,1-3H3,(H4,9,10,11,13).
What are the key properties of N-(diaminomethylidene)-4,4-dimethyl-3-oxopentanamide?
N-(diaminomethylidene)-4,4-dimethyl-3-oxopentanamide has a molecular weight of 185.23 g/mol, XLogP of -0.21, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diaminomethylidene)-4,4-dimethyl-3-oxopentanamide is sourced from PubChem (CID 58678963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).