C10H20N6O2 — CID 22639613
N,N'-bis(diaminomethylidene)octanediamide (PubChem CID 22639613) has the molecular formula C10H20N6O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is N,N'-bis(diaminomethylidene)octanediamide.
| Compound Name | N,N'-bis(diaminomethylidene)octanediamide |
|---|---|
| PubChem CID | 22639613 |
| Molecular Formula | C10H20N6O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N,N'-bis(diaminomethylidene)octanediamide |
| SMILES | NC(N)=NC(=O)CCCCCCC(=O)N=C(N)N |
| InChI | InChI=1S/C10H20N6O2/c11-9(12)15-7(17)5-3-1-2-4-6-8(18)16-10(13)14/h1-6H2,(H4,11,12,15,17)(H4,13,14,16,18) |
| InChIKey | ZOBNKERGXPIREC-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 162.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|