C10H21ClN10O4 — CID 175018028
bis[[amino-(diaminomethylideneamino)methylidene]amino] hexanedioate;hydrochloride (PubChem CID 175018028) has the molecular formula C10H21ClN10O4 and a molecular weight of 380.80 g/mol. Its IUPAC name is bis[[amino-(diaminomethylideneamino)methylidene]amino] hexanedioate;hydrochloride.
| Compound Name | bis[[amino-(diaminomethylideneamino)methylidene]amino] hexanedioate;hydrochloride |
|---|---|
| PubChem CID | 175018028 |
| Molecular Formula | C10H21ClN10O4 |
| Molecular Weight | 380.80 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | bis[[amino-(diaminomethylideneamino)methylidene]amino] hexanedioate;hydrochloride |
| SMILES | Cl.NC(N)=NC(N)=NOC(=O)CCCCC(=O)ON=C(N)N=C(N)N |
| InChI | InChI=1S/C10H20N10O4.ClH/c11-7(12)17-9(15)19-23-5(21)3-1-2-4-6(22)24-20-10(16)18-8(13)14;/h1-4H2,(H6,11,12,15,17,19)(H6,13,14,16,18,20);1H |
| InChIKey | NOFLVPNKIQIKHI-UHFFFAOYSA-N |
| XLogP | -2.94 |
| TPSA | 258.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.80 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|