C4H13N5O5S — CID 54605636
1-(diaminomethylidene)-2-ethoxyguanidine;sulfuric acid (PubChem CID 54605636) has the molecular formula C4H13N5O5S and a molecular weight of 243.24 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-ethoxyguanidine;sulfuric acid.
| Compound Name | 1-(diaminomethylidene)-2-ethoxyguanidine;sulfuric acid |
|---|---|
| PubChem CID | 54605636 |
| Molecular Formula | C4H13N5O5S |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 1-(diaminomethylidene)-2-ethoxyguanidine;sulfuric acid |
| SMILES | CCO/N=C(/N)N=C(N)N.O=S(=O)(O)O |
| InChI | InChI=1S/C4H11N5O.H2O4S/c1-2-10-9-4(7)8-3(5)6;1-5(2,3)4/h2H2,1H3,(H6,5,6,7,8,9);(H2,1,2,3,4) |
| InChIKey | CUWWEXQDBQYNKT-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 186.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|