About [[amino-(diaminomethylideneamino)methylidene]amino] N-octylsulfamate
[[amino-(diaminomethylideneamino)methylidene]amino] N-octylsulfamate (PubChem CID 175540744) has the molecular formula C10H24N6O3S
and a molecular weight of 308.41 g/mol. Its IUPAC name is [[amino-(diaminomethylideneamino)methylidene]amino] N-octylsulfamate.
Molecular Properties
| Compound Name | [[amino-(diaminomethylideneamino)methylidene]amino] N-octylsulfamate |
| PubChem CID | 175540744 |
| Molecular Formula | C10H24N6O3S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [[amino-(diaminomethylideneamino)methylidene]amino] N-octylsulfamate |
| SMILES | CCCCCCCCNS(=O)(=O)ON=C(N)N=C(N)N |
| InChI | InChI=1S/C10H24N6O3S/c1-2-3-4-5-6-7-8-14-20(17,18)19-16-10(13)15-9(11)12/h14H,2-8H2,1H3,(H6,11,12,13,15,16) |
| InChIKey | LSPPFUQQVFYIAF-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[amino-(diaminomethylideneamino)methylidene]amino] N-octylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[amino-(diaminomethylideneamino)methylidene]amino] N-octylsulfamate?
The IUPAC name of [[amino-(diaminomethylideneamino)methylidene]amino] N-octylsulfamate (CID 175540744) is [[amino-(diaminomethylideneamino)methylidene]amino] N-octylsulfamate.
What is the SMILES notation for [[amino-(diaminomethylideneamino)methylidene]amino] N-octylsulfamate?
The canonical SMILES for [[amino-(diaminomethylideneamino)methylidene]amino] N-octylsulfamate is CCCCCCCCNS(=O)(=O)ON=C(N)N=C(N)N.
What is the InChIKey of [[amino-(diaminomethylideneamino)methylidene]amino] N-octylsulfamate?
The InChIKey is LSPPFUQQVFYIAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N6O3S/c1-2-3-4-5-6-7-8-14-20(17,18)19-16-10(13)15-9(11)12/h14H,2-8H2,1H3,(H6,11,12,13,15,16).
What are the key properties of [[amino-(diaminomethylideneamino)methylidene]amino] N-octylsulfamate?
[[amino-(diaminomethylideneamino)methylidene]amino] N-octylsulfamate has a molecular weight of 308.41 g/mol, XLogP of -0.30, 10 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[amino-(diaminomethylideneamino)methylidene]amino] N-octylsulfamate is sourced from PubChem (CID 175540744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).