C8H16N2O2 — CID 20677078
2-N,3-N-diethoxybutane-2,3-diimine (PubChem CID 20677078) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-N,3-N-diethoxybutane-2,3-diimine.
| Compound Name | 2-N,3-N-diethoxybutane-2,3-diimine |
|---|---|
| PubChem CID | 20677078 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 2-N,3-N-diethoxybutane-2,3-diimine |
| SMILES | CCO/N=C(C)/C(C)=N/OCC |
| InChI | InChI=1S/C8H16N2O2/c1-5-11-9-7(3)8(4)10-12-6-2/h5-6H2,1-4H3/b9-7+,10-8+ |
| InChIKey | CSSPRZHZLVTYET-FIFLTTCUSA-N |
| XLogP | 1.81 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|