C5H9Br2NO3 — CID 175187018
acetic acid;1,1-dibromo-N-ethoxymethanimine (PubChem CID 175187018) has the molecular formula C5H9Br2NO3 and a molecular weight of 290.94 g/mol. Its IUPAC name is acetic acid;1,1-dibromo-N-ethoxymethanimine.
| Compound Name | acetic acid;1,1-dibromo-N-ethoxymethanimine |
|---|---|
| PubChem CID | 175187018 |
| Molecular Formula | C5H9Br2NO3 |
| Molecular Weight | 290.94 g/mol |
| Exact Mass | 288.89 |
| IUPAC Name | acetic acid;1,1-dibromo-N-ethoxymethanimine |
| SMILES | CC(=O)O.CCON=C(Br)Br |
| InChI | InChI=1S/C3H5Br2NO.C2H4O2/c1-2-7-6-3(4)5;1-2(3)4/h2H2,1H3;1H3,(H,3,4) |
| InChIKey | MJCBMBRCKVLSCZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.94 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|