About N'-ethoxy-N,N-diiodoethanimidamide
N'-ethoxy-N,N-diiodoethanimidamide (PubChem CID 139453376) has the molecular formula C4H8I2N2O
and a molecular weight of 353.93 g/mol. Its IUPAC name is N'-ethoxy-N,N-diiodoethanimidamide.
Molecular Properties
| Compound Name | N'-ethoxy-N,N-diiodoethanimidamide |
| PubChem CID | 139453376 |
| Molecular Formula | C4H8I2N2O |
| Molecular Weight | 353.93 g/mol |
| Exact Mass | 353.87 |
| IUPAC Name | N'-ethoxy-N,N-diiodoethanimidamide |
| SMILES | CCO/N=C(/C)N(I)I |
| InChI | InChI=1S/C4H8I2N2O/c1-3-9-7-4(2)8(5)6/h3H2,1-2H3/b7-4- |
| InChIKey | IICJWXGHCAPTHP-DAXSKMNVSA-N |
| XLogP | 2.36 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.93 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-ethoxy-N,N-diiodoethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethoxy-N,N-diiodoethanimidamide?
The IUPAC name of N'-ethoxy-N,N-diiodoethanimidamide (CID 139453376) is N'-ethoxy-N,N-diiodoethanimidamide.
What is the SMILES notation for N'-ethoxy-N,N-diiodoethanimidamide?
The canonical SMILES for N'-ethoxy-N,N-diiodoethanimidamide is CCO/N=C(/C)N(I)I.
What is the InChIKey of N'-ethoxy-N,N-diiodoethanimidamide?
The InChIKey is IICJWXGHCAPTHP-DAXSKMNVSA-N. The full InChI is InChI=1S/C4H8I2N2O/c1-3-9-7-4(2)8(5)6/h3H2,1-2H3/b7-4-.
What are the key properties of N'-ethoxy-N,N-diiodoethanimidamide?
N'-ethoxy-N,N-diiodoethanimidamide has a molecular weight of 353.93 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethoxy-N,N-diiodoethanimidamide is sourced from PubChem (CID 139453376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).