About sodium;(Z)-N-ethoxy-1-phosphorosooxypropan-2-imine;hydride
sodium;(Z)-N-ethoxy-1-phosphorosooxypropan-2-imine;hydride (PubChem CID 173083185) has the molecular formula C5H11NNaO3P
and a molecular weight of 187.11 g/mol. Its IUPAC name is sodium;(Z)-N-ethoxy-1-phosphorosooxypropan-2-imine;hydride.
Molecular Properties
| Compound Name | sodium;(Z)-N-ethoxy-1-phosphorosooxypropan-2-imine;hydride |
| PubChem CID | 173083185 |
| Molecular Formula | C5H11NNaO3P |
| Molecular Weight | 187.11 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | sodium;(Z)-N-ethoxy-1-phosphorosooxypropan-2-imine;hydride |
| SMILES | CCO/N=C(/C)COP=O.[H-].[Na+] |
| InChI | InChI=1S/C5H10NO3P.Na.H/c1-3-8-6-5(2)4-9-10-7;;/h3-4H2,1-2H3;;/q;+1;-1/b6-5-;; |
| InChIKey | SKDGTQIWRKPJKR-XNOMRPDFSA-N |
| XLogP | -1.26 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.11 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;(Z)-N-ethoxy-1-phosphorosooxypropan-2-imine;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;(Z)-N-ethoxy-1-phosphorosooxypropan-2-imine;hydride?
The IUPAC name of sodium;(Z)-N-ethoxy-1-phosphorosooxypropan-2-imine;hydride (CID 173083185) is sodium;(Z)-N-ethoxy-1-phosphorosooxypropan-2-imine;hydride.
What is the SMILES notation for sodium;(Z)-N-ethoxy-1-phosphorosooxypropan-2-imine;hydride?
The canonical SMILES for sodium;(Z)-N-ethoxy-1-phosphorosooxypropan-2-imine;hydride is CCO/N=C(/C)COP=O.[H-].[Na+].
What is the InChIKey of sodium;(Z)-N-ethoxy-1-phosphorosooxypropan-2-imine;hydride?
The InChIKey is SKDGTQIWRKPJKR-XNOMRPDFSA-N. The full InChI is InChI=1S/C5H10NO3P.Na.H/c1-3-8-6-5(2)4-9-10-7;;/h3-4H2,1-2H3;;/q;+1;-1/b6-5-;;.
What are the key properties of sodium;(Z)-N-ethoxy-1-phosphorosooxypropan-2-imine;hydride?
sodium;(Z)-N-ethoxy-1-phosphorosooxypropan-2-imine;hydride has a molecular weight of 187.11 g/mol, XLogP of -1.26, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;(Z)-N-ethoxy-1-phosphorosooxypropan-2-imine;hydride is sourced from PubChem (CID 173083185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).