About N-ethoxyhexan-2-imine
N-ethoxyhexan-2-imine (PubChem CID 86028505) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is N-ethoxyhexan-2-imine.
Molecular Properties
| Compound Name | N-ethoxyhexan-2-imine |
| PubChem CID | 86028505 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | N-ethoxyhexan-2-imine |
| SMILES | CCCCC(C)=NOCC |
| InChI | InChI=1S/C8H17NO/c1-4-6-7-8(3)9-10-5-2/h4-7H2,1-3H3 |
| InChIKey | KWDGKZSNFSHCIJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethoxyhexan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethoxyhexan-2-imine?
The IUPAC name of N-ethoxyhexan-2-imine (CID 86028505) is N-ethoxyhexan-2-imine.
What is the SMILES notation for N-ethoxyhexan-2-imine?
The canonical SMILES for N-ethoxyhexan-2-imine is CCCCC(C)=NOCC.
What is the InChIKey of N-ethoxyhexan-2-imine?
The InChIKey is KWDGKZSNFSHCIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-4-6-7-8(3)9-10-5-2/h4-7H2,1-3H3.
What are the key properties of N-ethoxyhexan-2-imine?
N-ethoxyhexan-2-imine has a molecular weight of 143.23 g/mol, XLogP of 2.59, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethoxyhexan-2-imine is sourced from PubChem (CID 86028505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).