About 2-ethoxyiminobutanal
2-ethoxyiminobutanal (PubChem CID 159082631) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is 2-ethoxyiminobutanal.
Molecular Properties
| Compound Name | 2-ethoxyiminobutanal |
| PubChem CID | 159082631 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 2-ethoxyiminobutanal |
| SMILES | CCON=C(C=O)CC |
| InChI | InChI=1S/C6H11NO2/c1-3-6(5-8)7-9-4-2/h5H,3-4H2,1-2H3 |
| InChIKey | KBAXOPVQXVKMOO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyiminobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyiminobutanal?
The IUPAC name of 2-ethoxyiminobutanal (CID 159082631) is 2-ethoxyiminobutanal.
What is the SMILES notation for 2-ethoxyiminobutanal?
The canonical SMILES for 2-ethoxyiminobutanal is CCON=C(C=O)CC.
What is the InChIKey of 2-ethoxyiminobutanal?
The InChIKey is KBAXOPVQXVKMOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2/c1-3-6(5-8)7-9-4-2/h5H,3-4H2,1-2H3.
What are the key properties of 2-ethoxyiminobutanal?
2-ethoxyiminobutanal has a molecular weight of 129.16 g/mol, XLogP of 0.99, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyiminobutanal is sourced from PubChem (CID 159082631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).