C7H11N3O3S — CID 173351810
(2Z)-2-(2-amino-3-hydroxy-2H-1,3-thiazol-4-yl)-2-ethoxyiminoacetaldehyde (PubChem CID 173351810) has the molecular formula C7H11N3O3S and a molecular weight of 217.25 g/mol. Its IUPAC name is (2Z)-2-(2-amino-3-hydroxy-2H-1,3-thiazol-4-yl)-2-ethoxyiminoacetaldehyde.
| Compound Name | (2Z)-2-(2-amino-3-hydroxy-2H-1,3-thiazol-4-yl)-2-ethoxyiminoacetaldehyde |
|---|---|
| PubChem CID | 173351810 |
| Molecular Formula | C7H11N3O3S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | (2Z)-2-(2-amino-3-hydroxy-2H-1,3-thiazol-4-yl)-2-ethoxyiminoacetaldehyde |
| SMILES | CCO/N=C(\C=O)C1=CSC(N)N1O |
| InChI | InChI=1S/C7H11N3O3S/c1-2-13-9-5(3-11)6-4-14-7(8)10(6)12/h3-4,7,12H,2,8H2,1H3/b9-5+ |
| InChIKey | LSGISNPDXQVYLK-WEVVVXLNSA-N |
| XLogP | 0.10 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|