About phenyl 2-ethoxyiminopropanoate
phenyl 2-ethoxyiminopropanoate (PubChem CID 175344932) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is phenyl 2-ethoxyiminopropanoate.
Molecular Properties
| Compound Name | phenyl 2-ethoxyiminopropanoate |
| PubChem CID | 175344932 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | phenyl 2-ethoxyiminopropanoate |
| SMILES | CCON=C(C)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C11H13NO3/c1-3-14-12-9(2)11(13)15-10-7-5-4-6-8-10/h4-8H,3H2,1-2H3 |
| InChIKey | FHQZBSANWHKKQF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 2-ethoxyiminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 2-ethoxyiminopropanoate?
The IUPAC name of phenyl 2-ethoxyiminopropanoate (CID 175344932) is phenyl 2-ethoxyiminopropanoate.
What is the SMILES notation for phenyl 2-ethoxyiminopropanoate?
The canonical SMILES for phenyl 2-ethoxyiminopropanoate is CCON=C(C)C(=O)Oc1ccccc1.
What is the InChIKey of phenyl 2-ethoxyiminopropanoate?
The InChIKey is FHQZBSANWHKKQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c1-3-14-12-9(2)11(13)15-10-7-5-4-6-8-10/h4-8H,3H2,1-2H3.
What are the key properties of phenyl 2-ethoxyiminopropanoate?
phenyl 2-ethoxyiminopropanoate has a molecular weight of 207.23 g/mol, XLogP of 2.00, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 2-ethoxyiminopropanoate is sourced from PubChem (CID 175344932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).