About bis(hydroxymethyl) hexanedioate
bis(hydroxymethyl) hexanedioate (PubChem CID 22892542) has the molecular formula C8H14O6
and a molecular weight of 206.19 g/mol. Its IUPAC name is bis(hydroxymethyl) hexanedioate.
Molecular Properties
| Compound Name | bis(hydroxymethyl) hexanedioate |
| PubChem CID | 22892542 |
| Molecular Formula | C8H14O6 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | bis(hydroxymethyl) hexanedioate |
| SMILES | O=C(CCCCC(=O)OCO)OCO |
| InChI | InChI=1S/C8H14O6/c9-5-13-7(11)3-1-2-4-8(12)14-6-10/h9-10H,1-6H2 |
| InChIKey | NVQRLSGTBGUHLH-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze bis(hydroxymethyl) hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(hydroxymethyl) hexanedioate?
The IUPAC name of bis(hydroxymethyl) hexanedioate (CID 22892542) is bis(hydroxymethyl) hexanedioate.
What is the SMILES notation for bis(hydroxymethyl) hexanedioate?
The canonical SMILES for bis(hydroxymethyl) hexanedioate is O=C(CCCCC(=O)OCO)OCO.
What is the InChIKey of bis(hydroxymethyl) hexanedioate?
The InChIKey is NVQRLSGTBGUHLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O6/c9-5-13-7(11)3-1-2-4-8(12)14-6-10/h9-10H,1-6H2.
What are the key properties of bis(hydroxymethyl) hexanedioate?
bis(hydroxymethyl) hexanedioate has a molecular weight of 206.19 g/mol, XLogP of -0.47, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(hydroxymethyl) hexanedioate is sourced from PubChem (CID 22892542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).