About bis(4-hydroxybut-2-ynyl) hexanedioate;6-O-(hydroxymethyl) 1-O-methyl hexanedioate
bis(4-hydroxybut-2-ynyl) hexanedioate;6-O-(hydroxymethyl) 1-O-methyl hexanedioate (PubChem CID 123989989) has the molecular formula C22H32O11
and a molecular weight of 472.49 g/mol. Its IUPAC name is bis(4-hydroxybut-2-ynyl) hexanedioate;6-O-(hydroxymethyl) 1-O-methyl hexanedioate.
Molecular Properties
| Compound Name | bis(4-hydroxybut-2-ynyl) hexanedioate;6-O-(hydroxymethyl) 1-O-methyl hexanedioate |
| PubChem CID | 123989989 |
| Molecular Formula | C22H32O11 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | bis(4-hydroxybut-2-ynyl) hexanedioate;6-O-(hydroxymethyl) 1-O-methyl hexanedioate |
| SMILES | COC(=O)CCCCC(=O)OCO.O=C(CCCCC(=O)OCC#CCO)OCC#CCO |
| InChI | InChI=1S/C14H18O6.C8H14O5/c15-9-3-5-11-19-13(17)7-1-2-8-14(18)20-12-6-4-10-16;1-12-7(10)4-2-3-5-8(11)13-6-9/h15-16H,1-2,7-12H2;9H,2-6H2,1H3 |
| InChIKey | KXRVIWDRAAYYGW-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(4-hydroxybut-2-ynyl) hexanedioate;6-O-(hydroxymethyl) 1-O-methyl hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-hydroxybut-2-ynyl) hexanedioate;6-O-(hydroxymethyl) 1-O-methyl hexanedioate?
The IUPAC name of bis(4-hydroxybut-2-ynyl) hexanedioate;6-O-(hydroxymethyl) 1-O-methyl hexanedioate (CID 123989989) is bis(4-hydroxybut-2-ynyl) hexanedioate;6-O-(hydroxymethyl) 1-O-methyl hexanedioate.
What is the SMILES notation for bis(4-hydroxybut-2-ynyl) hexanedioate;6-O-(hydroxymethyl) 1-O-methyl hexanedioate?
The canonical SMILES for bis(4-hydroxybut-2-ynyl) hexanedioate;6-O-(hydroxymethyl) 1-O-methyl hexanedioate is COC(=O)CCCCC(=O)OCO.O=C(CCCCC(=O)OCC#CCO)OCC#CCO.
What is the InChIKey of bis(4-hydroxybut-2-ynyl) hexanedioate;6-O-(hydroxymethyl) 1-O-methyl hexanedioate?
The InChIKey is KXRVIWDRAAYYGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O6.C8H14O5/c15-9-3-5-11-19-13(17)7-1-2-8-14(18)20-12-6-4-10-16;1-12-7(10)4-2-3-5-8(11)13-6-9/h15-16H,1-2,7-12H2;9H,2-6H2,1H3.
What are the key properties of bis(4-hydroxybut-2-ynyl) hexanedioate;6-O-(hydroxymethyl) 1-O-methyl hexanedioate?
bis(4-hydroxybut-2-ynyl) hexanedioate;6-O-(hydroxymethyl) 1-O-methyl hexanedioate has a molecular weight of 472.49 g/mol, XLogP of -0.16, 13 rotatable bonds, 3 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-hydroxybut-2-ynyl) hexanedioate;6-O-(hydroxymethyl) 1-O-methyl hexanedioate is sourced from PubChem (CID 123989989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).