C10H18N6O5 — CID 174906007
6-(hydroxymethoxy)-6-oxohexanoic acid;1,3,5-triazine-2,4,6-triamine (PubChem CID 174906007) has the molecular formula C10H18N6O5 and a molecular weight of 302.29 g/mol. Its IUPAC name is 6-(hydroxymethoxy)-6-oxohexanoic acid;1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-(hydroxymethoxy)-6-oxohexanoic acid;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 174906007 |
| Molecular Formula | C10H18N6O5 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 6-(hydroxymethoxy)-6-oxohexanoic acid;1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1nc(N)nc(N)n1.O=C(O)CCCCC(=O)OCO |
| InChI | InChI=1S/C7H12O5.C3H6N6/c8-5-12-7(11)4-2-1-3-6(9)10;4-1-7-2(5)9-3(6)8-1/h8H,1-5H2,(H,9,10);(H6,4,5,6,7,8,9) |
| InChIKey | UOSWOYCWAOGSHN-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 200.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|