C9H16O10 — CID 174576056
2,3-dihydroxybutanedioic acid;hydroxymethyl 4-hydroxybutanoate (PubChem CID 174576056) has the molecular formula C9H16O10 and a molecular weight of 284.22 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;hydroxymethyl 4-hydroxybutanoate.
| Compound Name | 2,3-dihydroxybutanedioic acid;hydroxymethyl 4-hydroxybutanoate |
|---|---|
| PubChem CID | 174576056 |
| Molecular Formula | C9H16O10 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;hydroxymethyl 4-hydroxybutanoate |
| SMILES | O=C(CCCO)OCO.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C5H10O4.C4H6O6/c6-3-1-2-5(8)9-4-7;5-1(3(7)8)2(6)4(9)10/h6-7H,1-4H2;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | NDFKZDLOKJTOBE-UHFFFAOYSA-N |
| XLogP | -2.87 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|