About 6-amino-N-[N'-(6-aminohexanoyl)carbamimidoyl]hexanamide;hydrochloride
6-amino-N-[N'-(6-aminohexanoyl)carbamimidoyl]hexanamide;hydrochloride (PubChem CID 44783950) has the molecular formula C13H28ClN5O2
and a molecular weight of 321.85 g/mol. Its IUPAC name is 6-amino-N-[N'-(6-aminohexanoyl)carbamimidoyl]hexanamide;hydrochloride.
Molecular Properties
| Compound Name | 6-amino-N-[N'-(6-aminohexanoyl)carbamimidoyl]hexanamide;hydrochloride |
| PubChem CID | 44783950 |
| Molecular Formula | C13H28ClN5O2 |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 6-amino-N-[N'-(6-aminohexanoyl)carbamimidoyl]hexanamide;hydrochloride |
| SMILES | Cl.NCCCCCC(=O)/N=C(\N)NC(=O)CCCCCN |
| InChI | InChI=1S/C13H27N5O2.ClH/c14-9-5-1-3-7-11(19)17-13(16)18-12(20)8-4-2-6-10-15;/h1-10,14-15H2,(H3,16,17,18,19,20);1H |
| InChIKey | KMKHRBRBESKOQF-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-N-[N'-(6-aminohexanoyl)carbamimidoyl]hexanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-N-[N'-(6-aminohexanoyl)carbamimidoyl]hexanamide;hydrochloride?
The IUPAC name of 6-amino-N-[N'-(6-aminohexanoyl)carbamimidoyl]hexanamide;hydrochloride (CID 44783950) is 6-amino-N-[N'-(6-aminohexanoyl)carbamimidoyl]hexanamide;hydrochloride.
What is the SMILES notation for 6-amino-N-[N'-(6-aminohexanoyl)carbamimidoyl]hexanamide;hydrochloride?
The canonical SMILES for 6-amino-N-[N'-(6-aminohexanoyl)carbamimidoyl]hexanamide;hydrochloride is Cl.NCCCCCC(=O)/N=C(\N)NC(=O)CCCCCN.
What is the InChIKey of 6-amino-N-[N'-(6-aminohexanoyl)carbamimidoyl]hexanamide;hydrochloride?
The InChIKey is KMKHRBRBESKOQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N5O2.ClH/c14-9-5-1-3-7-11(19)17-13(16)18-12(20)8-4-2-6-10-15;/h1-10,14-15H2,(H3,16,17,18,19,20);1H.
What are the key properties of 6-amino-N-[N'-(6-aminohexanoyl)carbamimidoyl]hexanamide;hydrochloride?
6-amino-N-[N'-(6-aminohexanoyl)carbamimidoyl]hexanamide;hydrochloride has a molecular weight of 321.85 g/mol, XLogP of 0.40, 10 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-N-[N'-(6-aminohexanoyl)carbamimidoyl]hexanamide;hydrochloride is sourced from PubChem (CID 44783950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).