C7H13NO5 — CID 174583020
4,4-dimethyl-3-oxopentanoic acid;nitrous acid (PubChem CID 174583020) has the molecular formula C7H13NO5 and a molecular weight of 191.18 g/mol. Its IUPAC name is 4,4-dimethyl-3-oxopentanoic acid;nitrous acid.
| Compound Name | 4,4-dimethyl-3-oxopentanoic acid;nitrous acid |
|---|---|
| PubChem CID | 174583020 |
| Molecular Formula | C7H13NO5 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 4,4-dimethyl-3-oxopentanoic acid;nitrous acid |
| SMILES | CC(C)(C)C(=O)CC(=O)O.O=NO |
| InChI | InChI=1S/C7H12O3.HNO2/c1-7(2,3)5(8)4-6(9)10;2-1-3/h4H2,1-3H3,(H,9,10);(H,2,3) |
| InChIKey | IMHJTYZKVUCMKN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|