C14H32O8P2S — CID 102166253
2-[di(propan-2-yloxy)phosphorylmethylsulfonylmethyl-propan-2-yloxyphosphoryl]oxypropane (PubChem CID 102166253) has the molecular formula C14H32O8P2S and a molecular weight of 422.42 g/mol. Its IUPAC name is 2-[di(propan-2-yloxy)phosphorylmethylsulfonylmethyl-propan-2-yloxyphosphoryl]oxypropane.
| Compound Name | 2-[di(propan-2-yloxy)phosphorylmethylsulfonylmethyl-propan-2-yloxyphosphoryl]oxypropane |
|---|---|
| PubChem CID | 102166253 |
| Molecular Formula | C14H32O8P2S |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 2-[di(propan-2-yloxy)phosphorylmethylsulfonylmethyl-propan-2-yloxyphosphoryl]oxypropane |
| SMILES | CC(C)OP(=O)(CS(=O)(=O)CP(=O)(OC(C)C)OC(C)C)OC(C)C |
| InChI | InChI=1S/C14H32O8P2S/c1-11(2)19-23(15,20-12(3)4)9-25(17,18)10-24(16,21-13(5)6)22-14(7)8/h11-14H,9-10H2,1-8H3 |
| InChIKey | FQTPDRYZRLTVCZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|