C22H41O5PS — CID 102166254
(2E,6E,10E)-13-[di(propan-2-yloxy)phosphorylmethylsulfonyl]-6,10-dimethyltrideca-2,6,10-triene (PubChem CID 102166254) has the molecular formula C22H41O5PS and a molecular weight of 448.61 g/mol. Its IUPAC name is (2E,6E,10E)-13-[di(propan-2-yloxy)phosphorylmethylsulfonyl]-6,10-dimethyltrideca-2,6,10-triene.
| Compound Name | (2E,6E,10E)-13-[di(propan-2-yloxy)phosphorylmethylsulfonyl]-6,10-dimethyltrideca-2,6,10-triene |
|---|---|
| PubChem CID | 102166254 |
| Molecular Formula | C22H41O5PS |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | (2E,6E,10E)-13-[di(propan-2-yloxy)phosphorylmethylsulfonyl]-6,10-dimethyltrideca-2,6,10-triene |
| SMILES | C/C=C/CC/C(C)=C/CC/C(C)=C/CCS(=O)(=O)CP(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C22H41O5PS/c1-8-9-10-13-21(6)14-11-15-22(7)16-12-17-29(24,25)18-28(23,26-19(2)3)27-20(4)5/h8-9,14,16,19-20H,10-13,15,17-18H2,1-7H3/b9-8+,21-14+,22-16+ |
| InChIKey | FSKLRHVYLVFAFV-LELGFGOLSA-N |
| XLogP | 6.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|