C16H29O5PS — CID 102166255
[(3E,7E,11E)-4,8-dimethyltrideca-3,7,11-trienyl]sulfonylmethylphosphonic acid (PubChem CID 102166255) has the molecular formula C16H29O5PS and a molecular weight of 364.44 g/mol. Its IUPAC name is [(3E,7E,11E)-4,8-dimethyltrideca-3,7,11-trienyl]sulfonylmethylphosphonic acid.
| Compound Name | [(3E,7E,11E)-4,8-dimethyltrideca-3,7,11-trienyl]sulfonylmethylphosphonic acid |
|---|---|
| PubChem CID | 102166255 |
| Molecular Formula | C16H29O5PS |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | [(3E,7E,11E)-4,8-dimethyltrideca-3,7,11-trienyl]sulfonylmethylphosphonic acid |
| SMILES | C/C=C/CC/C(C)=C/CC/C(C)=C/CCS(=O)(=O)CP(=O)(O)O |
| InChI | InChI=1S/C16H29O5PS/c1-4-5-6-9-15(2)10-7-11-16(3)12-8-13-23(20,21)14-22(17,18)19/h4-5,10,12H,6-9,11,13-14H2,1-3H3,(H2,17,18,19)/b5-4+,15-10+,16-12+ |
| InChIKey | AFENUPITMJJAJG-QLYCQYFZSA-N |
| XLogP | 3.96 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|