C13H22O — CID 21432644
(5E,10E)-6-methyldodeca-5,10-dien-2-one (PubChem CID 21432644) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is (5E,10E)-6-methyldodeca-5,10-dien-2-one.
| Compound Name | (5E,10E)-6-methyldodeca-5,10-dien-2-one |
|---|---|
| PubChem CID | 21432644 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (5E,10E)-6-methyldodeca-5,10-dien-2-one |
| SMILES | C/C=C/CCC/C(C)=C/CCC(C)=O |
| InChI | InChI=1S/C13H22O/c1-4-5-6-7-9-12(2)10-8-11-13(3)14/h4-5,10H,6-9,11H2,1-3H3/b5-4+,12-10+ |
| InChIKey | TYRBVDZJLWYHKG-JOKBTEAVSA-N |
| XLogP | 4.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|