C23H36Cl2 — CID 165392266
(2Z,6E,10E,14E,18Z)-2,18-dichloro-6,10,14-trimethylicosa-2,6,10,14,18-pentaene (PubChem CID 165392266) has the molecular formula C23H36Cl2 and a molecular weight of 383.45 g/mol. Its IUPAC name is (2Z,6E,10E,14E,18Z)-2,18-dichloro-6,10,14-trimethylicosa-2,6,10,14,18-pentaene.
| Compound Name | (2Z,6E,10E,14E,18Z)-2,18-dichloro-6,10,14-trimethylicosa-2,6,10,14,18-pentaene |
|---|---|
| PubChem CID | 165392266 |
| Molecular Formula | C23H36Cl2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | (2Z,6E,10E,14E,18Z)-2,18-dichloro-6,10,14-trimethylicosa-2,6,10,14,18-pentaene |
| SMILES | C/C=C(\Cl)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(/C)Cl |
| InChI | InChI=1S/C23H36Cl2/c1-6-23(25)18-10-16-21(4)14-8-12-19(2)11-7-13-20(3)15-9-17-22(5)24/h6,12-13,16-17H,7-11,14-15,18H2,1-5H3/b19-12+,20-13+,21-16+,22-17-,23-6- |
| InChIKey | UBSYHJJXVKZZRX-BNYCZFOESA-N |
| XLogP | 9.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|