C19H34O2S2 — CID 88970906
(2E,6E)-1-(2-ethylsulfonylethylsulfanyl)-3,7,11-trimethyldodeca-2,6,10-triene (PubChem CID 88970906) has the molecular formula C19H34O2S2 and a molecular weight of 358.61 g/mol. Its IUPAC name is (2E,6E)-1-(2-ethylsulfonylethylsulfanyl)-3,7,11-trimethyldodeca-2,6,10-triene.
| Compound Name | (2E,6E)-1-(2-ethylsulfonylethylsulfanyl)-3,7,11-trimethyldodeca-2,6,10-triene |
|---|---|
| PubChem CID | 88970906 |
| Molecular Formula | C19H34O2S2 |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (2E,6E)-1-(2-ethylsulfonylethylsulfanyl)-3,7,11-trimethyldodeca-2,6,10-triene |
| SMILES | CCS(=O)(=O)CCSC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C19H34O2S2/c1-6-23(20,21)16-15-22-14-13-19(5)12-8-11-18(4)10-7-9-17(2)3/h9,11,13H,6-8,10,12,14-16H2,1-5H3/b18-11+,19-13+ |
| InChIKey | YQKVUWFUTLEOBJ-NWLVNBMCSA-N |
| XLogP | 5.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|