C17H29BrS — CID 71498387
(2E,6E)-1-(2-bromoethylsulfanyl)-3,7,11-trimethyldodeca-2,6,10-triene (PubChem CID 71498387) has the molecular formula C17H29BrS and a molecular weight of 345.39 g/mol. Its IUPAC name is (2E,6E)-1-(2-bromoethylsulfanyl)-3,7,11-trimethyldodeca-2,6,10-triene.
| Compound Name | (2E,6E)-1-(2-bromoethylsulfanyl)-3,7,11-trimethyldodeca-2,6,10-triene |
|---|---|
| PubChem CID | 71498387 |
| Molecular Formula | C17H29BrS |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (2E,6E)-1-(2-bromoethylsulfanyl)-3,7,11-trimethyldodeca-2,6,10-triene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSCCBr |
| InChI | InChI=1S/C17H29BrS/c1-15(2)7-5-8-16(3)9-6-10-17(4)11-13-19-14-12-18/h7,9,11H,5-6,8,10,12-14H2,1-4H3/b16-9+,17-11+ |
| InChIKey | QBIYBYFULYDMII-BTMZFSHUSA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|