C19H31ClOS — CID 21189503
1-chloro-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbutan-2-one (PubChem CID 21189503) has the molecular formula C19H31ClOS and a molecular weight of 342.98 g/mol. Its IUPAC name is 1-chloro-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbutan-2-one.
| Compound Name | 1-chloro-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbutan-2-one |
|---|---|
| PubChem CID | 21189503 |
| Molecular Formula | C19H31ClOS |
| Molecular Weight | 342.98 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 1-chloro-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbutan-2-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSCCC(=O)CCl |
| InChI | InChI=1S/C19H31ClOS/c1-16(2)7-5-8-17(3)9-6-10-18(4)11-13-22-14-12-19(21)15-20/h7,9,11H,5-6,8,10,12-15H2,1-4H3/b17-9+,18-11+ |
| InChIKey | GVDLRRMFNIJFFX-XURGJTJWSA-N |
| XLogP | 6.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.98 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|