C22H35NO5S — CID 130368670
(2S)-2-[(2-methoxy-2-oxoacetyl)amino]-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbutanoic acid (PubChem CID 130368670) has the molecular formula C22H35NO5S and a molecular weight of 425.59 g/mol. Its IUPAC name is (2S)-2-[(2-methoxy-2-oxoacetyl)amino]-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbutanoic acid.
| Compound Name | (2S)-2-[(2-methoxy-2-oxoacetyl)amino]-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 130368670 |
| Molecular Formula | C22H35NO5S |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | (2S)-2-[(2-methoxy-2-oxoacetyl)amino]-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbutanoic acid |
| SMILES | COC(=O)C(=O)N[C@@H](CCSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C22H35NO5S/c1-16(2)8-6-9-17(3)10-7-11-18(4)12-14-29-15-13-19(21(25)26)23-20(24)22(27)28-5/h8,10,12,19H,6-7,9,11,13-15H2,1-5H3,(H,23,24)(H,25,26)/b17-10+,18-12+/t19-/m0/s1 |
| InChIKey | SRNRXKHVGAXHLC-QQESMQTJSA-N |
| XLogP | 4.27 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|