C10H20ClF2O4P — CID 102390088
1-chloro-4-di(propan-2-yloxy)phosphoryl-4,4-difluorobutan-2-ol (PubChem CID 102390088) has the molecular formula C10H20ClF2O4P and a molecular weight of 308.69 g/mol. Its IUPAC name is 1-chloro-4-di(propan-2-yloxy)phosphoryl-4,4-difluorobutan-2-ol.
| Compound Name | 1-chloro-4-di(propan-2-yloxy)phosphoryl-4,4-difluorobutan-2-ol |
|---|---|
| PubChem CID | 102390088 |
| Molecular Formula | C10H20ClF2O4P |
| Molecular Weight | 308.69 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 1-chloro-4-di(propan-2-yloxy)phosphoryl-4,4-difluorobutan-2-ol |
| SMILES | CC(C)OP(=O)(OC(C)C)C(F)(F)CC(O)CCl |
| InChI | InChI=1S/C10H20ClF2O4P/c1-7(2)16-18(15,17-8(3)4)10(12,13)5-9(14)6-11/h7-9,14H,5-6H2,1-4H3 |
| InChIKey | GLBTUDACMVYXOJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.69 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|