C13H28Cl2O9P3- — CID 23419610
[dichloro-di(propan-2-yloxy)phosphorylmethyl]-di(propan-2-yloxy)phosphoryloxyphosphinate (PubChem CID 23419610) has the molecular formula C13H28Cl2O9P3- and a molecular weight of 492.19 g/mol. Its IUPAC name is [dichloro-di(propan-2-yloxy)phosphorylmethyl]-di(propan-2-yloxy)phosphoryloxyphosphinate.
| Compound Name | [dichloro-di(propan-2-yloxy)phosphorylmethyl]-di(propan-2-yloxy)phosphoryloxyphosphinate |
|---|---|
| PubChem CID | 23419610 |
| Molecular Formula | C13H28Cl2O9P3- |
| Molecular Weight | 492.19 g/mol |
| Exact Mass | 491.03 |
| IUPAC Name | [dichloro-di(propan-2-yloxy)phosphorylmethyl]-di(propan-2-yloxy)phosphoryloxyphosphinate |
| SMILES | CC(C)OP(=O)(OC(C)C)OP(=O)([O-])C(Cl)(Cl)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C13H29Cl2O9P3/c1-9(2)20-26(18,21-10(3)4)13(14,15)25(16,17)24-27(19,22-11(5)6)23-12(7)8/h9-12H,1-8H3,(H,16,17)/p-1 |
| InChIKey | VNOWVBSWEJIOOT-UHFFFAOYSA-M |
| XLogP | 5.65 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.19 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|