C12H23Cl2O5P — CID 23336335
butan-2-yl 2,2-dichloro-2-di(propan-2-yloxy)phosphorylacetate (PubChem CID 23336335) has the molecular formula C12H23Cl2O5P and a molecular weight of 349.19 g/mol. Its IUPAC name is butan-2-yl 2,2-dichloro-2-di(propan-2-yloxy)phosphorylacetate.
| Compound Name | butan-2-yl 2,2-dichloro-2-di(propan-2-yloxy)phosphorylacetate |
|---|---|
| PubChem CID | 23336335 |
| Molecular Formula | C12H23Cl2O5P |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | butan-2-yl 2,2-dichloro-2-di(propan-2-yloxy)phosphorylacetate |
| SMILES | CCC(C)OC(=O)C(Cl)(Cl)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C12H23Cl2O5P/c1-7-10(6)17-11(15)12(13,14)20(16,18-8(2)3)19-9(4)5/h8-10H,7H2,1-6H3 |
| InChIKey | UKWGBGRYZOHHEJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|