C8H14Cl2NaO5P — CID 88779435
sodium (2-butan-2-yloxy-1,1-dichloro-2-oxoethyl)-ethoxyphosphinate (PubChem CID 88779435) has the molecular formula C8H14Cl2NaO5P and a molecular weight of 315.07 g/mol. Its IUPAC name is sodium (2-butan-2-yloxy-1,1-dichloro-2-oxoethyl)-ethoxyphosphinate.
| Compound Name | sodium (2-butan-2-yloxy-1,1-dichloro-2-oxoethyl)-ethoxyphosphinate |
|---|---|
| PubChem CID | 88779435 |
| Molecular Formula | C8H14Cl2NaO5P |
| Molecular Weight | 315.07 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | sodium (2-butan-2-yloxy-1,1-dichloro-2-oxoethyl)-ethoxyphosphinate |
| SMILES | CCOP(=O)([O-])C(Cl)(Cl)C(=O)OC(C)CC.[Na+] |
| InChI | InChI=1S/C8H15Cl2O5P.Na/c1-4-6(3)15-7(11)8(9,10)16(12,13)14-5-2;/h6H,4-5H2,1-3H3,(H,12,13);/q;+1/p-1 |
| InChIKey | WFTUHABASFMQKU-UHFFFAOYSA-M |
| XLogP | -0.95 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.07 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|