About dipotassium;butan-2-yl phosphate
dipotassium;butan-2-yl phosphate (PubChem CID 21353345) has the molecular formula C4H9K2O4P
and a molecular weight of 230.28 g/mol. Its IUPAC name is dipotassium;butan-2-yl phosphate.
Molecular Properties
| Compound Name | dipotassium;butan-2-yl phosphate |
| PubChem CID | 21353345 |
| Molecular Formula | C4H9K2O4P |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 229.95 |
| IUPAC Name | dipotassium;butan-2-yl phosphate |
| SMILES | CCC(C)OP(=O)([O-])[O-].[K+].[K+] |
| InChI | InChI=1S/C4H11O4P.2K/c1-3-4(2)8-9(5,6)7;;/h4H,3H2,1-2H3,(H2,5,6,7);;/q;2*+1/p-2 |
| InChIKey | VRWNXHSSRMWPAL-UHFFFAOYSA-L |
| XLogP | -6.36 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | -6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;butan-2-yl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;butan-2-yl phosphate?
The IUPAC name of dipotassium;butan-2-yl phosphate (CID 21353345) is dipotassium;butan-2-yl phosphate.
What is the SMILES notation for dipotassium;butan-2-yl phosphate?
The canonical SMILES for dipotassium;butan-2-yl phosphate is CCC(C)OP(=O)([O-])[O-].[K+].[K+].
What is the InChIKey of dipotassium;butan-2-yl phosphate?
The InChIKey is VRWNXHSSRMWPAL-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H11O4P.2K/c1-3-4(2)8-9(5,6)7;;/h4H,3H2,1-2H3,(H2,5,6,7);;/q;2*+1/p-2.
What are the key properties of dipotassium;butan-2-yl phosphate?
dipotassium;butan-2-yl phosphate has a molecular weight of 230.28 g/mol, XLogP of -6.36, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;butan-2-yl phosphate is sourced from PubChem (CID 21353345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).