C4H9O2PS2Zn — CID 88795040
zinc butan-2-yloxy-oxido-sulfanylidene-sulfido-λ5-phosphane (PubChem CID 88795040) has the molecular formula C4H9O2PS2Zn and a molecular weight of 249.61 g/mol. Its IUPAC name is zinc butan-2-yloxy-oxido-sulfanylidene-sulfido-λ5-phosphane.
| Compound Name | zinc butan-2-yloxy-oxido-sulfanylidene-sulfido-λ5-phosphane |
|---|---|
| PubChem CID | 88795040 |
| Molecular Formula | C4H9O2PS2Zn |
| Molecular Weight | 249.61 g/mol |
| Exact Mass | 247.91 |
| IUPAC Name | zinc butan-2-yloxy-oxido-sulfanylidene-sulfido-λ5-phosphane |
| SMILES | CCC(C)OP([O-])(=S)[S-].[Zn+2] |
| InChI | InChI=1S/C4H11O2PS2.Zn/c1-3-4(2)6-7(5,8)9;/h4H,3H2,1-2H3,(H2,5,8,9);/q;+2/p-2 |
| InChIKey | OXRPKXGVHAYGQK-UHFFFAOYSA-L |
| XLogP | 0.93 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.61 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|