CH3Na2O2PS2 — CID 172832566
disodium;methoxy-oxido-sulfanylidene-sulfido-λ5-phosphane (PubChem CID 172832566) has the molecular formula CH3Na2O2PS2 and a molecular weight of 188.12 g/mol. Its IUPAC name is disodium;methoxy-oxido-sulfanylidene-sulfido-λ5-phosphane.
| Compound Name | disodium;methoxy-oxido-sulfanylidene-sulfido-λ5-phosphane |
|---|---|
| PubChem CID | 172832566 |
| Molecular Formula | CH3Na2O2PS2 |
| Molecular Weight | 188.12 g/mol |
| Exact Mass | 187.91 |
| IUPAC Name | disodium;methoxy-oxido-sulfanylidene-sulfido-λ5-phosphane |
| SMILES | COP([O-])(=S)[S-].[Na+].[Na+] |
| InChI | InChI=1S/CH5O2PS2.2Na/c1-3-4(2,5)6;;/h1H3,(H2,2,5,6);;/q;2*+1/p-2 |
| InChIKey | VSBORNFIVNCMCN-UHFFFAOYSA-L |
| XLogP | -6.23 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.12 |
| LogP ≤ 5 | -6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|