C16H36O4P2S4Zn — CID 87788943
zinc bis(bis[(2-methylpropan-2-yl)oxy]-sulfanylidene-sulfido-λ5-phosphane) (PubChem CID 87788943) has the molecular formula C16H36O4P2S4Zn and a molecular weight of 548.07 g/mol. Its IUPAC name is zinc bis(bis[(2-methylpropan-2-yl)oxy]-sulfanylidene-sulfido-λ5-phosphane).
| Compound Name | zinc bis(bis[(2-methylpropan-2-yl)oxy]-sulfanylidene-sulfido-λ5-phosphane) |
|---|---|
| PubChem CID | 87788943 |
| Molecular Formula | C16H36O4P2S4Zn |
| Molecular Weight | 548.07 g/mol |
| Exact Mass | 546.03 |
| IUPAC Name | zinc bis(bis[(2-methylpropan-2-yl)oxy]-sulfanylidene-sulfido-λ5-phosphane) |
| SMILES | CC(C)(C)OP(=S)([S-])OC(C)(C)C.CC(C)(C)OP(=S)([S-])OC(C)(C)C.[Zn+2] |
| InChI | InChI=1S/2C8H19O2PS2.Zn/c2*1-7(2,3)9-11(12,13)10-8(4,5)6;/h2*1-6H3,(H,12,13);/q;;+2/p-2 |
| InChIKey | YYGCGOWCXMSGOJ-UHFFFAOYSA-L |
| XLogP | 6.77 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.07 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|