C13H26Cl2NO4P — CID 23336336
propan-2-yl 2,2-dichloro-2-[[di(propan-2-yl)amino]-ethoxyphosphoryl]acetate (PubChem CID 23336336) has the molecular formula C13H26Cl2NO4P and a molecular weight of 362.23 g/mol. Its IUPAC name is propan-2-yl 2,2-dichloro-2-[[di(propan-2-yl)amino]-ethoxyphosphoryl]acetate.
| Compound Name | propan-2-yl 2,2-dichloro-2-[[di(propan-2-yl)amino]-ethoxyphosphoryl]acetate |
|---|---|
| PubChem CID | 23336336 |
| Molecular Formula | C13H26Cl2NO4P |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | propan-2-yl 2,2-dichloro-2-[[di(propan-2-yl)amino]-ethoxyphosphoryl]acetate |
| SMILES | CCOP(=O)(N(C(C)C)C(C)C)C(Cl)(Cl)C(=O)OC(C)C |
| InChI | InChI=1S/C13H26Cl2NO4P/c1-8-19-21(18,16(9(2)3)10(4)5)13(14,15)12(17)20-11(6)7/h9-11H,8H2,1-7H3 |
| InChIKey | BFQADUKGSSNBQH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|