C10H16Cl2O5 — CID 139631018
dipropan-2-yl 2,2-dichloro-3-hydroxybutanedioate (PubChem CID 139631018) has the molecular formula C10H16Cl2O5 and a molecular weight of 287.14 g/mol. Its IUPAC name is dipropan-2-yl 2,2-dichloro-3-hydroxybutanedioate.
| Compound Name | dipropan-2-yl 2,2-dichloro-3-hydroxybutanedioate |
|---|---|
| PubChem CID | 139631018 |
| Molecular Formula | C10H16Cl2O5 |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | dipropan-2-yl 2,2-dichloro-3-hydroxybutanedioate |
| SMILES | CC(C)OC(=O)C(O)C(Cl)(Cl)C(=O)OC(C)C |
| InChI | InChI=1S/C10H16Cl2O5/c1-5(2)16-8(14)7(13)10(11,12)9(15)17-6(3)4/h5-7,13H,1-4H3 |
| InChIKey | PPCKCJOESNUZGB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|